|
CAS#: 94201-86-2 Product: 1-(2-Chloro-P-Tolyl)-3-[4-(Dimethylamino)Phenyl]Urea No suppilers available for the product. |
| Name | 1-(2-Chloro-P-Tolyl)-3-[4-(Dimethylamino)Phenyl]Urea |
|---|---|
| Synonyms | 3-(2-Chloro-4-Methyl-Phenyl)-1-(4-Dimethylaminophenyl)Urea; 1-(2-Chloro-P-Tolyl)-3-(4-(Dimethylamino)Phenyl)Urea |
| Molecular Structure | ![]() |
| Molecular Formula | C16H18ClN3O |
| Molecular Weight | 303.79 |
| CAS Registry Number | 94201-86-2 |
| EINECS | 303-676-8 |
| SMILES | C1=CC(=CC(=C1NC(=O)NC2=CC=C(N(C)C)C=C2)Cl)C |
| InChI | 1S/C16H18ClN3O/c1-11-4-9-15(14(17)10-11)19-16(21)18-12-5-7-13(8-6-12)20(2)3/h4-10H,1-3H3,(H2,18,19,21) |
| InChIKey | BHCYFWQGBSVKLP-UHFFFAOYSA-N |
| Density | 1.287g/cm3 (Cal.) |
|---|---|
| Boiling point | 369.96°C at 760 mmHg (Cal.) |
| Flash point | 177.545°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(2-Chloro-P-Tolyl)-3-[4-(Dimethylamino)Phenyl]Urea |