Online Database of Chemicals from Around the World
|
CAS#: 94201-97-5 Product: 4-Oxo-4-(3,4,5-Trimethoxyphenyl)-2-Butenoic Acid No suppilers available for the product. |
| Name | 4-Oxo-4-(3,4,5-Trimethoxyphenyl)-2-Butenoic Acid |
|---|---|
| Synonyms | (E)-4-Keto-4-(3,4,5-Trimethoxyphenyl)But-2-Enoic Acid; Baxitozinum [Inn-Latin]; Ru 38086 |
| Molecular Structure |  |
| Molecular Formula | C13H14O6 |
| Molecular Weight | 266.25 |
| CAS Registry Number | 94201-97-5 |
| EINECS | 303-688-3 |
| SMILES | C1=C(C(=C(C=C1C(\C=C\C(O)=O)=O)OC)OC)OC |
| InChI | 1S/C13H14O6/c1-17-10-6-8(9(14)4-5-12(15)16)7-11(18-2)13(10)19-3/h4-7H,1-3H3,(H,15,16)/b5-4+ |
| InChIKey | PVCWLTQMJSUKGZ-SNAWJCMRSA-N |
| Density | 1.243g/cm3 (Cal.) |
|---|---|
| Boiling point | 457.948°C at 760 mmHg (Cal.) |
| Flash point | 174.332°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Oxo-4-(3,4,5-Trimethoxyphenyl)-2-Butenoic Acid |