|
CAS#: 94213-19-1 Product: Butylethylbis(2-Hydroxyethyl)Ammonium Ethyl Sulphate No suppilers available for the product. |
| Name | Butylethylbis(2-Hydroxyethyl)Ammonium Ethyl Sulphate |
|---|---|
| Synonyms | Bis(2-Hydroxyethyl)-(1-Methylpentyl)Ammonium; Ethyl Sulfate; Butylethylbis(2-Hydroxyethyl)Ammonium Ethyl Sulphate |
| Molecular Structure | ![]() |
| Molecular Formula | C12H29NO6S |
| Molecular Weight | 315.42 |
| CAS Registry Number | 94213-19-1 |
| EINECS | 303-721-1 |
| SMILES | C(O[S]([O-])(=O)=O)C.C([NH+](C(CCCC)C)CCO)CO |
| InChI | 1S/C10H23NO2.C2H6O4S/c1-3-4-5-10(2)11(6-8-12)7-9-13;1-2-6-7(3,4)5/h10,12-13H,3-9H2,1-2H3;2H2,1H3,(H,3,4,5) |
| InChIKey | ZSXSTBDXLNXMEZ-UHFFFAOYSA-N |
| Boiling point | 305.2°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 134.6°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Butylethylbis(2-Hydroxyethyl)Ammonium Ethyl Sulphate |