|
CAS#: 94213-43-1 Product: 3-[1-(2,3-Dichlorophenyl)Ethylidene]Carbazamidine No suppilers available for the product. |
| Name | 3-[1-(2,3-Dichlorophenyl)Ethylidene]Carbazamidine |
|---|---|
| Synonyms | 3-(1-(2,3-Dichlorophenyl)Ethylidene)Carbazamidine |
| Molecular Structure | ![]() |
| Molecular Formula | C9H10Cl2N4 |
| Molecular Weight | 245.11 |
| CAS Registry Number | 94213-43-1 |
| EINECS | 303-747-3 |
| SMILES | C1=CC=C(Cl)C(=C1C(=N/N=C(N)N)/C)Cl |
| InChI | 1S/C9H10Cl2N4/c1-5(14-15-9(12)13)6-3-2-4-7(10)8(6)11/h2-4H,1H3,(H4,12,13,15)/b14-5+ |
| InChIKey | MLWONQDCGJOILV-LHHJGKSTSA-N |
| Density | 1.444g/cm3 (Cal.) |
|---|---|
| Boiling point | 413.032°C at 760 mmHg (Cal.) |
| Flash point | 203.595°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-[1-(2,3-Dichlorophenyl)Ethylidene]Carbazamidine |