|
CAS#: 94223-87-7 Product: 10-Methylacenaphtho[1,2-b]Quinoline No suppilers available for the product. |
| Name | 10-Methylacenaphtho[1,2-b]Quinoline |
|---|---|
| Synonyms | 10-Methylacenaphtho[2,1-B]Quinoline; Ccris 6582; 10-Methyl-Acenaphtho(1,2-B)Quinoline |
| Molecular Structure | ![]() |
| Molecular Formula | C20H13N |
| Molecular Weight | 267.33 |
| CAS Registry Number | 94223-87-7 (94223-88-8) |
| SMILES | C2=C1C=C(C=CC1=NC4=C2C3=C5C(=CC=C3)C=CC=C45)C |
| InChI | 1S/C20H13N/c1-12-8-9-18-14(10-12)11-17-15-6-2-4-13-5-3-7-16(19(13)15)20(17)21-18/h2-11H,1H3 |
| InChIKey | LLCTUSJTCJPCJC-UHFFFAOYSA-N |
| Density | 1.3g/cm3 (Cal.) |
|---|---|
| Boiling point | 487.897°C at 760 mmHg (Cal.) |
| Flash point | 218.863°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 10-Methylacenaphtho[1,2-b]Quinoline |