|
CAS#: 94213-46-4 Product: 1-[4-(4-bromophenyl)phenyl]-1-(4-chlorophenyl)propan-1-ol No suppilers available for the product. |
| Name | 1-[4-(4-bromophenyl)phenyl]-1-(4-chlorophenyl)propan-1-ol |
|---|---|
| Synonyms | 4'-bromo- |
| Molecular Structure | ![]() |
| Molecular Formula | C21H18BrClO |
| Molecular Weight | 401.72 |
| CAS Registry Number | 94213-46-4 |
| EINECS | 303-751-5 |
| SMILES | Brc1ccc(cc1)c2ccc(cc2)C(O)(CC)c3ccc(Cl)cc3 |
| InChI | 1S/C21H18BrClO/c1-2-21(24,18-9-13-20(23)14-10-18)17-7-3-15(4-8-17)16-5-11-19(22)12-6-16/h3-14,24H,2H2,1H3 |
| InChIKey | LEAKGJUKXLUPJY-UHFFFAOYSA-N |
| Density | 1.368g/cm3 (Cal.) |
|---|---|
| Boiling point | 509.819°C at 760 mmHg (Cal.) |
| Flash point | 262.129°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-[4-(4-bromophenyl)phenyl]-1-(4-chlorophenyl)propan-1-ol |