|
CAS#: 94231-43-3 Product: 4-Methylbenzyl 2-Methylbutyrate No suppilers available for the product. |
| Name | 4-Methylbenzyl 2-Methylbutyrate |
|---|---|
| Synonyms | 2-Methylbutanoic Acid (4-Methylphenyl)Methyl Ester; 2-Methylbutyric Acid (4-Methylbenzyl) Ester; Butanoic Acid, 2-Methyl-, (4-Methylphenyl)Methyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C13H18O2 |
| Molecular Weight | 206.28 |
| CAS Registry Number | 94231-43-3 |
| EINECS | 303-860-8 |
| SMILES | C1=C(COC(=O)C(CC)C)C=CC(=C1)C |
| InChI | 1S/C13H18O2/c1-4-11(3)13(14)15-9-12-7-5-10(2)6-8-12/h5-8,11H,4,9H2,1-3H3 |
| InChIKey | OUFFFGFYTMZJHK-UHFFFAOYSA-N |
| Density | 0.99g/cm3 (Cal.) |
|---|---|
| Boiling point | 274.588°C at 760 mmHg (Cal.) |
| Flash point | 103.05°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Methylbenzyl 2-Methylbutyrate |