|
CAS#: 94232-01-6 Product: 2-[(4-Aminophenyl)Amino]-5-Nitrobenzenesulphonic Acid Hydrochloride No suppilers available for the product. |
| Name | 2-[(4-Aminophenyl)Amino]-5-Nitrobenzenesulphonic Acid Hydrochloride |
|---|---|
| Synonyms | 2-[(4-Aminophenyl)Amino]-5-Nitro-Benzenesulfonic Acid Hydrochloride; 2-((4-Aminophenyl)Amino)-5-Nitrobenzenesulphonic Acid Hydrochloride |
| Molecular Structure | ![]() |
| Molecular Formula | C12H12ClN3O5S |
| Molecular Weight | 345.76 |
| CAS Registry Number | 94232-01-6 |
| EINECS | 303-925-0 |
| SMILES | [H+].C1=C([N+]([O-])=O)C=CC(=C1[S](O)(=O)=O)NC2=CC=C(N)C=C2.[Cl-] |
| InChI | 1S/C12H11N3O5S.ClH/c13-8-1-3-9(4-2-8)14-11-6-5-10(15(16)17)7-12(11)21(18,19)20;/h1-7,14H,13H2,(H,18,19,20);1H |
| InChIKey | ODQRSGUUAKFPFM-UHFFFAOYSA-N |
| Boiling point | 594.9°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 313.6°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-[(4-Aminophenyl)Amino]-5-Nitrobenzenesulphonic Acid Hydrochloride |