|
CAS#: 94237-10-2 Product: phenyl-[1-tris(1-benzoylcyclohexoxy)silyloxycyclohexyl]methanone No suppilers available for the product. |
| Name | phenyl-[1-tris(1-benzoylcyclohexoxy)silyloxycyclohexyl]methanone |
|---|---|
| Synonyms | [silanete |
| Molecular Structure | ![]() |
| Molecular Formula | C52H60O8Si |
| Molecular Weight | 841.11 |
| CAS Registry Number | 94237-10-2 |
| EINECS | 304-109-7 |
| SMILES | O=C(c1ccccc1)C2(CCCCC2)O[Si](OC3(CCCCC3)C(=O)c4ccccc4)(OC5(CCCCC5)C(=O)c6ccccc6)OC7(CCCCC7)C(=O)c8ccccc8 |
| InChI | 1S/C52H60O8Si/c53-45(41-25-9-1-10-26-41)49(33-17-5-18-34-49)57-61(58-50(35-19-6-20-36-50)46(54)42-27-11-2-12-28-42,59-51(37-21-7-22-38-51)47(55)43-29-13-3-14-30-43)60-52(39-23-8-24-40-52)48(56)44-31-15-4-16-32-44/h1-4,9-16,25-32H,5-8,17-24,33-40H2 |
| InChIKey | BRJVGTLSPCNXLK-UHFFFAOYSA-N |
| Density | 1.216g/cm3 (Cal.) |
|---|---|
| Boiling point | 859.19°C at 760 mmHg (Cal.) |
| Flash point | 393.081°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for phenyl-[1-tris(1-benzoylcyclohexoxy)silyloxycyclohexyl]methanone |