|
CAS#: 94237-21-5 Product: Bis[Tris(2-Hydroxyethyl)Ammonium] Nitroheptanedioate No suppilers available for the product. |
| Name | Bis[Tris(2-Hydroxyethyl)Ammonium] Nitroheptanedioate |
|---|---|
| Synonyms | bis[tris(2-hydroxyethyl)ammonium] nitroheptanedioate |
| Molecular Structure | ![]() |
| Molecular Formula | C19H41N3O12 |
| Molecular Weight | 503.54 |
| CAS Registry Number | 94237-21-5 |
| EINECS | 304-121-2 |
| SMILES | OCC[NH+](CCO)CCO.[O-]C(=O)C(CCCCC([O-])=O)[N+]([O-])=O.OCC[NH+](CCO)CCO |
| InChI | 1S/C7H11NO6.2C6H15NO3/c9-6(10)4-2-1-3-5(7(11)12)8(13)14;2*8-4-1-7(2-5-9)3-6-10/h5H,1-4H2,(H,9,10)(H,11,12);2*8-10H,1-6H2 |
| InChIKey | HHXIFUXZIFFBLH-UHFFFAOYSA-N |
| Boiling point | 824.9°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 452.7°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Bis[Tris(2-Hydroxyethyl)Ammonium] Nitroheptanedioate |