|
CAS#: 94247-51-5 Product: 2-(2-Benzyloxy-2-oxo-ethyl)tetradec-4-enoate No suppilers available for the product. |
| Name | 2-(2-Benzyloxy-2-oxo-ethyl)tetradec-4-enoate |
|---|---|
| Synonyms | 4-benzyl hydrogen 2-dodecenylsuccinate |
| Molecular Structure | ![]() |
| Molecular Formula | C23H33O4 |
| Molecular Weight | 373.51 |
| CAS Registry Number | 94247-51-5 |
| EINECS | 304-223-7 |
| SMILES | [O-]C(=O)C(CC=CCCCCCCCCC)CC(=O)OCc1ccccc1 |
| InChI | 1S/C23H34O4/c1-2-3-4-5-6-7-8-9-10-14-17-21(23(25)26)18-22(24)27-19-20-15-12-11-13-16-20/h10-16,21H,2-9,17-19H2,1H3,(H,25,26)/p-1 |
| InChIKey | DTZCEDKZDHFJOH-UHFFFAOYSA-M |
| Boiling point | 516.319°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 169.201°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(2-Benzyloxy-2-oxo-ethyl)tetradec-4-enoate |