|
CAS#: 94248-56-3 Product: [(1R,2R,3R,4S)-2,3,4,5-tetrakis[(2-bromoacetyl)oxy]-1-(hydroxymethyl)pentyl] 2-bromoacetate No suppilers available for the product. |
| Name | [(1R,2R,3R,4S)-2,3,4,5-tetrakis[(2-bromoacetyl)oxy]-1-(hydroxymethyl)pentyl] 2-bromoacetate |
|---|---|
| Synonyms | D-glucitol pentakis(bromoacetate) |
| Molecular Structure | ![]() |
| Molecular Formula | C16H19Br5O11 |
| Molecular Weight | 786.84 |
| CAS Registry Number | 94248-56-3 |
| EINECS | 304-329-3 |
| SMILES | O=C(O[C@H](CO)[C@@H](OC(=O)CBr)[C@H](OC(=O)CBr)[C@H](COC(=O)CBr)OC(=O)CBr)CBr |
| InChI | 1S/C16H19Br5O11/c17-1-10(23)28-7-9(30-12(25)3-19)16(32-14(27)5-21)15(31-13(26)4-20)8(6-22)29-11(24)2-18/h8-9,15-16,22H,1-7H2/t8-,9+,15-,16-/m1/s1 |
| InChIKey | HTDFEOMEJJBSFB-PSNKQFAISA-N |
| Density | 2.098g/cm3 (Cal.) |
|---|---|
| Boiling point | 651.448°C at 760 mmHg (Cal.) |
| Flash point | 347.783°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for [(1R,2R,3R,4S)-2,3,4,5-tetrakis[(2-bromoacetyl)oxy]-1-(hydroxymethyl)pentyl] 2-bromoacetate |