Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054//+86 13424336463 | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com, | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 2,3-Dihydronaphtho[2,3-b][1,4]dioxine-6-carbonitrile |
|---|---|
| Synonyms | 2,3-dihydronaphtho[2,3-b][1,4]dioxine-6-carbonitrile |
| Molecular Structure | ![CAS#: 942631-86-9, 2,3-Dihydronaphtho[2,3-b][1,4]dioxine-6-carbonitrile](/moreStructures/942631-86-9.gif) |
| Molecular Formula | C13H9NO2 |
| Molecular Weight | 211.22 |
| CAS Registry Number | 942631-86-9 |
| SMILES | c1cc2cc3c(cc2c(c1)C#N)OCCO3 |
| InChI | 1S/C13H9NO2/c14-8-10-3-1-2-9-6-12-13(7-11(9)10)16-5-4-15-12/h1-3,6-7H,4-5H2 |
| InChIKey | YUKRLNZZPVSLGJ-UHFFFAOYSA-N |
| Density | 1.32g/cm3 (Cal.) |
|---|---|
| Boiling point | 398.467°C at 760 mmHg (Cal.) |
| Flash point | 162.408°C (Cal.) |
| Refractive index | 1.667 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,3-Dihydronaphtho[2,3-b][1,4]dioxine-6-carbonitrile |