|
CAS#: 94278-35-0 Product: 7-Methoxy-5,7-Dimethyl-2,4-Octadien-1-Ol No suppilers available for the product. |
| Name | 7-Methoxy-5,7-Dimethyl-2,4-Octadien-1-Ol |
|---|---|
| Synonyms | (2E,4E)-7-Methoxy-5,7-Dimethyl-Octa-2,4-Dien-1-Ol; 7-Methoxy-5,7-Dimethyl-2,4-Octadien-1-Ol |
| Molecular Structure | ![]() |
| Molecular Formula | C11H20O2 |
| Molecular Weight | 184.28 |
| CAS Registry Number | 94278-35-0 |
| EINECS | 304-725-6 |
| SMILES | C(C(OC)(C)C)\C(=C\C=C\CO)C |
| InChI | 1S/C11H20O2/c1-10(7-5-6-8-12)9-11(2,3)13-4/h5-7,12H,8-9H2,1-4H3/b6-5+,10-7+ |
| InChIKey | OISBPHGRISAQQI-WEYXYWBQSA-N |
| Density | 0.917g/cm3 (Cal.) |
|---|---|
| Boiling point | 271.798°C at 760 mmHg (Cal.) |
| Flash point | 101.431°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 7-Methoxy-5,7-Dimethyl-2,4-Octadien-1-Ol |