|
CAS#: 94278-39-4 Product: 2-Ethylbutyl Cyclopent-2-Ene-1-Acetate No suppilers available for the product. |
| Name | 2-Ethylbutyl Cyclopent-2-Ene-1-Acetate |
|---|---|
| Synonyms | 2-[1-(2-Ethylbutyl)-1-Cyclopent-2-Enyl]Ethanoate; 2-Ethylbutyl Cyclopent-2-Ene-1-Acetate |
| Molecular Structure | ![]() |
| Molecular Formula | C13H21O2 |
| Molecular Weight | 209.31 |
| CAS Registry Number | 94278-39-4 |
| EINECS | 304-729-8 |
| SMILES | C(C1(C=CCC1)CC([O-])=O)C(CC)CC |
| InChI | 1S/C13H22O2/c1-3-11(4-2)9-13(10-12(14)15)7-5-6-8-13/h5,7,11H,3-4,6,8-10H2,1-2H3,(H,14,15)/p-1 |
| InChIKey | NSQHMZBPVHWXRS-UHFFFAOYSA-M |
| Boiling point | 318.245°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 215.31°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Ethylbutyl Cyclopent-2-Ene-1-Acetate |