|
CAS#: 94291-44-8 Product: 6-Methyl-3-(1-Methylcyclopropyl)Hept-2-En-1-Ol No suppilers available for the product. |
| Name | 6-Methyl-3-(1-Methylcyclopropyl)Hept-2-En-1-Ol |
|---|---|
| Synonyms | 6-Methyl-3-(1-Methylcyclopropyl)Hept-2-En-1-Ol |
| Molecular Structure | ![]() |
| Molecular Formula | C12H22O |
| Molecular Weight | 182.31 |
| CAS Registry Number | 94291-44-8 |
| EINECS | 304-867-9 |
| SMILES | C(O)\C=C(C1(CC1)C)/CCC(C)C |
| InChI | 1S/C12H22O/c1-10(2)4-5-11(6-9-13)12(3)7-8-12/h6,10,13H,4-5,7-9H2,1-3H3/b11-6+ |
| InChIKey | WQRXXEWXBPIPMP-IZZDOVSWSA-N |
| Density | 0.929g/cm3 (Cal.) |
|---|---|
| Boiling point | 251.805°C at 760 mmHg (Cal.) |
| Flash point | 92.436°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-Methyl-3-(1-Methylcyclopropyl)Hept-2-En-1-Ol |