|
CAS#: 94291-64-2 Product: 10,11-Dihydro-N,5-Dimethyl-5H-Dibenz[b,f]Azepin-10-Amine Oxalate No suppilers available for the product. |
| Name | 10,11-Dihydro-N,5-Dimethyl-5H-Dibenz[b,f]Azepin-10-Amine Oxalate |
|---|---|
| Synonyms | 10,11-dih |
| Molecular Structure | ![]() |
| Molecular Formula | C18H20N2O4 |
| Molecular Weight | 328.36 |
| CAS Registry Number | 94291-64-2 |
| EINECS | 304-889-9 |
| SMILES | OC(=O)C(O)=O.CNC2Cc1ccccc1N(C)c3ccccc23 |
| InChI | 1S/C16H18N2.C2H2O4/c1-17-14-11-12-7-3-5-9-15(12)18(2)16-10-6-4-8-13(14)16;3-1(4)2(5)6/h3-10,14,17H,11H2,1-2H3;(H,3,4)(H,5,6) |
| InChIKey | USTLUBMTLHVUHQ-UHFFFAOYSA-N |
| Boiling point | 534.1°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 276.8°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 10,11-Dihydro-N,5-Dimethyl-5H-Dibenz[b,f]Azepin-10-Amine Oxalate |