|
CAS#: 94307-51-4 Product: 2-Phenyl-6-(2-Phenylethenyl)Pyran-4-One No suppilers available for the product. |
| Name | 2-Phenyl-6-(2-Phenylethenyl)Pyran-4-One |
|---|---|
| Synonyms | 2-Phenyl-6-[(E)-2-Phenylethenyl]Pyran-4-One; 2-Phenyl-6-(2-Phenylvinyl)Pyran-4-One; 2-Phenyl-6-[(E)-2-Phenylvinyl]Pyran-4-One |
| Molecular Structure | ![]() |
| Molecular Formula | C19H14O2 |
| Molecular Weight | 274.32 |
| CAS Registry Number | 94307-51-4 |
| SMILES | C1=CC=CC=C1/C=C/C2=CC(=O)C=C(O2)C3=CC=CC=C3 |
| InChI | 1S/C19H14O2/c20-17-13-18(12-11-15-7-3-1-4-8-15)21-19(14-17)16-9-5-2-6-10-16/h1-14H/b12-11+ |
| InChIKey | XKHXNCXAVJCXKW-VAWYXSNFSA-N |
| Density | 1.253g/cm3 (Cal.) |
|---|---|
| Boiling point | 497.297°C at 760 mmHg (Cal.) |
| Flash point | 233.564°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Phenyl-6-(2-Phenylethenyl)Pyran-4-One |