|
CAS#: 94313-79-8 Product: 1,4-dihydroxy-2-[3-(2-methoxyethoxy)propylamino]anthracene-9,10-dione No suppilers available for the product. |
| Name | 1,4-dihydroxy-2-[3-(2-methoxyethoxy)propylamino]anthracene-9,10-dione |
|---|---|
| Synonyms | 1,4-dihyd |
| Molecular Structure | ![]() |
| Molecular Formula | C20H21NO6 |
| Molecular Weight | 371.38 |
| CAS Registry Number | 94313-79-8 |
| EINECS | 304-978-2 |
| SMILES | O=C2c1ccccc1C(=O)c3c2c(O)cc(NCCCOCCOC)c3O |
| InChI | 1S/C20H21NO6/c1-26-9-10-27-8-4-7-21-14-11-15(22)16-17(20(14)25)19(24)13-6-3-2-5-12(13)18(16)23/h2-3,5-6,11,21-22,25H,4,7-10H2,1H3 |
| InChIKey | ZSFWKWLNASMXLT-UHFFFAOYSA-N |
| Density | 1.372g/cm3 (Cal.) |
|---|---|
| Boiling point | 605.215°C at 760 mmHg (Cal.) |
| Flash point | 319.822°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,4-dihydroxy-2-[3-(2-methoxyethoxy)propylamino]anthracene-9,10-dione |