|
CAS#: 94383-67-2 Product: 1,5-Diphenylbicyclo[3.2.0]Heptane No suppilers available for the product. |
| Name | 1,5-Diphenylbicyclo[3.2.0]Heptane |
|---|---|
| Synonyms | 1,5-Diphenylbicyclo(3.2.0)Heptane; 1,5-Diphenylbicyclo[3.2.0]Heptane |
| Molecular Structure | ![]() |
| Molecular Formula | C19H20 |
| Molecular Weight | 248.37 |
| CAS Registry Number | 94383-67-2 |
| SMILES | C1=CC=C(C=C1)C23CCCC2(CC3)C4=CC=CC=C4 |
| InChI | 1S/C19H20/c1-3-8-16(9-4-1)18-12-7-13-19(18,15-14-18)17-10-5-2-6-11-17/h1-6,8-11H,7,12-15H2 |
| InChIKey | ITJCELKBMFHZCC-UHFFFAOYSA-N |
| Density | 1.113g/cm3 (Cal.) |
|---|---|
| Boiling point | 347.4°C at 760 mmHg (Cal.) |
| Flash point | 174.742°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,5-Diphenylbicyclo[3.2.0]Heptane |