|
CAS#: 944-32-1 Product: [4-(Trimethylsilyl)phenyl]trimethylstannane No suppilers available for the product. |
| Name | [4-(Trimethylsilyl)phenyl]trimethylstannane |
|---|---|
| Synonyms | Nsc 294228; Silane, Trimethyl(4-(Trimethylstannyl)Phenyl)- (9Ci); Silane, Trimethyl(P-(Trimethylstannyl)Phenyl)- (8Ci) |
| Molecular Structure | ![]() |
| Molecular Formula | C12H22SiSn |
| Molecular Weight | 313.08 |
| CAS Registry Number | 944-32-1 |
| SMILES | C1=CC(=CC=C1[Si](C)(C)C)[Sn](C)(C)C |
| InChI | 1S/C9H13Si.3CH3.Sn/c1-10(2,3)9-7-5-4-6-8-9;;;;/h5-8H,1-3H3;3*1H3; |
| InChIKey | DDIYHUXRNFWPPX-UHFFFAOYSA-N |
| Boiling point | 273.54°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 119.233°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for [4-(Trimethylsilyl)phenyl]trimethylstannane |