|
CAS#: 94442-02-1 Product: 2-(4-Neopentylphenoxy)Aniline No suppilers available for the product. |
| Name | 2-(4-Neopentylphenoxy)Aniline |
|---|---|
| Synonyms | [2-(4-Neopentylphenoxy)Phenyl]Amine; 2-(4-Neopentylphenoxy)Aniline |
| Molecular Structure | ![]() |
| Molecular Formula | C17H21NO |
| Molecular Weight | 255.36 |
| CAS Registry Number | 94442-02-1 |
| EINECS | 305-328-0 |
| SMILES | C1=CC(=CC=C1OC2=C(N)C=CC=C2)CC(C)(C)C |
| InChI | 1S/C17H21NO/c1-17(2,3)12-13-8-10-14(11-9-13)19-16-7-5-4-6-15(16)18/h4-11H,12,18H2,1-3H3 |
| InChIKey | OJQBKBWOUORGAL-UHFFFAOYSA-N |
| Density | 1.044g/cm3 (Cal.) |
|---|---|
| Boiling point | 354.721°C at 760 mmHg (Cal.) |
| Flash point | 156.257°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(4-Neopentylphenoxy)Aniline |