| International Laboratory Limited | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (650) 278-9963 | |||
![]() |
admin@intlab.org | |||
| Chemical manufacturer since 2002 | ||||
| Name | Tetrachloroveratrol |
|---|---|
| Synonyms | 1,2,3,4-Tetrachloro-5,6-Dimethoxy-Benzene; Tetrachloroveratrole; 3,4,5,6-Tetrachloroveratrole |
| Molecular Structure | ![]() |
| Molecular Formula | C8H6Cl4O2 |
| Molecular Weight | 275.95 |
| CAS Registry Number | 944-61-6 |
| SMILES | COC1=C(OC)C(=C(C(=C1Cl)Cl)Cl)Cl |
| InChI | 1S/C8H6Cl4O2/c1-13-7-5(11)3(9)4(10)6(12)8(7)14-2/h1-2H3 |
| InChIKey | NCYHCGGUQGDEQW-UHFFFAOYSA-N |
| Density | 1.49g/cm3 (Cal.) |
|---|---|
| Boiling point | 318.504°C at 760 mmHg (Cal.) |
| Flash point | 122.142°C (Cal.) |
| (1) | Yang Song, Sean Parkin and Hans-Joachim Lehmler . 1-Bromo-2,3,6-trichloro-4,5-dimethoxybenzene , Acta Cryst (2010). E66, o487Â Â |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Tetrachloroveratrol |