|
CAS#: 944-85-4 Product: 1-(Trimethylstannyl)naphthalene No suppilers available for the product. |
| Name | 1-(Trimethylstannyl)naphthalene |
|---|---|
| Synonyms | Trimethyl-(1-Naphthyl)Stannane; Trimethyl-Naphthalen-1-Yl-Stannane; 1-Naphthyltrimethylstannane |
| Molecular Structure | ![]() |
| Molecular Formula | C13H16Sn |
| Molecular Weight | 290.96 |
| CAS Registry Number | 944-85-4 |
| SMILES | C1=CC=C2C(=C1[Sn](C)(C)C)C=CC=C2 |
| InChI | 1S/C10H7.3CH3.Sn/c1-2-6-10-8-4-3-7-9(10)5-1;;;;/h1-7H;3*1H3; |
| InChIKey | GJINSWLNWKLWCH-UHFFFAOYSA-N |
| Boiling point | 309.451°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 144.814°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(Trimethylstannyl)naphthalene |