|
CAS#: 94500-54-6 Product: 11-Chloromethylbenzo[a]Pyrene No suppilers available for the product. |
| Name | 11-Chloromethylbenzo[a]Pyrene |
|---|---|
| Synonyms | Brn 5561773; Ccris 2525; 11-Chloromethylbenzo(A)Pyrene |
| Molecular Structure | ![]() |
| Molecular Formula | C21H13Cl |
| Molecular Weight | 300.79 |
| CAS Registry Number | 94500-54-6 |
| SMILES | C1=C5C3=C(C2=C1C=CC=C2)C(=CC4=C3C(=CC=C4)C=C5)CCl |
| InChI | 1S/C21H13Cl/c22-12-17-11-15-6-3-5-13-8-9-16-10-14-4-1-2-7-18(14)20(17)21(16)19(13)15/h1-11H,12H2 |
| InChIKey | YNFWZKLFAYROMP-UHFFFAOYSA-N |
| Density | 1.344g/cm3 (Cal.) |
|---|---|
| Boiling point | 521.879°C at 760 mmHg (Cal.) |
| Flash point | 243.569°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 11-Chloromethylbenzo[a]Pyrene |