| MP Biomedicals LLC. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (440) 337-1200 | |||
![]() |
info@mpbio.com | |||
| Chemical manufacturer | ||||
| Name | Methyl-Di(Phenyl)Arsane |
|---|---|
| Synonyms | Methyldiphenylarsine |
| Molecular Structure | ![]() |
| Molecular Formula | C13H13As |
| Molecular Weight | 244.17 |
| CAS Registry Number | 945-48-2 |
| EINECS | 213-414-3 |
| SMILES | C1=CC=CC=C1[As](C2=CC=CC=C2)C |
| InChI | 1S/C13H13As/c1-14(12-8-4-2-5-9-12)13-10-6-3-7-11-13/h2-11H,1H3 |
| InChIKey | CADPTFMOCGIPOI-UHFFFAOYSA-N |
| Boiling point | 285.976°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 118.911°C (Cal.) |
| (1) | Uwe Monkowius, Manfred Zabel and Hartmut Yersin . [mu]-Bis(diphenylarsino)methane-[kappa]2As:As'-bis[chloridogold(I)] , Acta Cryst (2009). E65, m281Â Â |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Methyl-Di(Phenyl)Arsane |