|
CAS#: 945-78-8 Product: (2Z)-3-Methyl-2-(1-Nitrosoethylidene)-1H-Benzimidazole No suppilers available for the product. |
| Name | (2Z)-3-Methyl-2-(1-Nitrosoethylidene)-1H-Benzimidazole |
|---|---|
| Synonyms | Ketone, Methyl 1-Methyl-2-Benzimidazolyl, Oxime; 1-Methyl-2-Acetylbenzimidazole Oxime; 5-24-03-00239 (Beilstein Handbook Reference) |
| Molecular Structure | ![]() |
| Molecular Formula | C10H11N3O |
| Molecular Weight | 189.22 |
| CAS Registry Number | 945-78-8 |
| SMILES | C2=C1N(\C(NC1=CC=C2)=C(N=O)\C)C |
| InChI | 1S/C10H11N3O/c1-7(12-14)10-11-8-5-3-4-6-9(8)13(10)2/h3-6,11H,1-2H3/b10-7- |
| InChIKey | BBRRVOYWGUPXIC-YFHOEESVSA-N |
| Density | 1.242g/cm3 (Cal.) |
|---|---|
| Boiling point | 261.747°C at 760 mmHg (Cal.) |
| Flash point | 112.101°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2Z)-3-Methyl-2-(1-Nitrosoethylidene)-1H-Benzimidazole |