|
CAS#: 94617-29-5 Product: Thiochrome Caproate No suppilers available for the product. |
| Name | Thiochrome Caproate |
|---|---|
| Synonyms | Thiochrome Caproate |
| Molecular Structure | ![]() |
| Molecular Formula | C18H24N4O2S |
| Molecular Weight | 360.47 |
| CAS Registry Number | 94617-29-5 |
| SMILES | C1=C2C(=NC(=N1)C)N=C3N(C2)C(=C(CCOC(CCCCC)=O)S3)C |
| InChI | 1S/C18H24N4O2S/c1-4-5-6-7-16(23)24-9-8-15-12(2)22-11-14-10-19-13(3)20-17(14)21-18(22)25-15/h10H,4-9,11H2,1-3H3 |
| InChIKey | ZJDIBIOAUBFOOX-UHFFFAOYSA-N |
| Density | 1.3g/cm3 (Cal.) |
|---|---|
| Boiling point | 512.105°C at 760 mmHg (Cal.) |
| Flash point | 263.512°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Thiochrome Caproate |