|
CAS#: 94818-84-5 Product: Phenacein No suppilers available for the product. |
| Name | Phenacein |
|---|---|
| Synonyms | 6-Hydroxy-3-Keto-5H-Phenazine-1-Carboxylic Acid; 1-Phenazinecarboxylic Acid, 3,6-Dihydroxy-; 3,6-Dihydroxy-1-Phenazinecarboxylic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C13H8N2O4 |
| Molecular Weight | 256.22 |
| CAS Registry Number | 94818-84-5 |
| SMILES | C1=CC=C(O)C3=C1N=C2C(=CC(=O)C=C2C(O)=O)N3 |
| InChI | 1S/C13H8N2O4/c16-6-4-7(13(18)19)11-9(5-6)15-12-8(14-11)2-1-3-10(12)17/h1-5,15,17H,(H,18,19) |
| InChIKey | GWSIQHUBLBTSBD-UHFFFAOYSA-N |
| Density | 1.654g/cm3 (Cal.) |
|---|---|
| Boiling point | 491.517°C at 760 mmHg (Cal.) |
| Flash point | 251.06°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Phenacein |