|
CAS#: 950-17-4 Product: 2-Chloro-1,1-diphenyl-ethanol No suppilers available for the product. |
| Name | 2-Chloro-1,1-diphenyl-ethanol |
|---|---|
| Synonyms | Nsc30273 |
| Molecular Structure | ![]() |
| Molecular Formula | C14H13ClO |
| Molecular Weight | 232.71 |
| CAS Registry Number | 950-17-4 |
| SMILES | C2=C(C(C1=CC=CC=C1)(CCl)O)C=CC=C2 |
| InChI | 1S/C14H13ClO/c15-11-14(16,12-7-3-1-4-8-12)13-9-5-2-6-10-13/h1-10,16H,11H2 |
| InChIKey | OIWPMKVQRVMTQU-UHFFFAOYSA-N |
| Density | 1.193g/cm3 (Cal.) |
|---|---|
| Boiling point | 374.453°C at 760 mmHg (Cal.) |
| Flash point | 165.564°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Chloro-1,1-diphenyl-ethanol |