|
CAS#: 952664-99-2 Product: 2-tert-butyl-5-nitro-1H-indole-7-carboxylic acid No suppilers available for the product. |
| Name | 2-tert-butyl-5-nitro-1H-indole-7-carboxylic acid |
|---|---|
| Synonyms | 2-tert-butyl-5-nitro-1H-indole-7-carboxylic acid |
| Molecular Formula | C13H14N2O4 |
| Molecular Weight | 262.26 |
| CAS Registry Number | 952664-99-2 |
| SMILES | CC(C)(C)c1cc2cc(cc(c2[nH]1)C(=O)O)[N+](=O)[O-] |
| InChI | 1S/C13H14N2O4/c1-13(2,3)10-5-7-4-8(15(18)19)6-9(12(16)17)11(7)14-10/h4-6,14H,1-3H3,(H,16,17) |
| InChIKey | ZXRVTTQBJADJPU-UHFFFAOYSA-N |
| Density | 1.359g/cm3 (Cal.) |
|---|---|
| Boiling point | 483.98°C at 760 mmHg (Cal.) |
| Flash point | 246.503°C (Cal.) |
| Refractive index | 1.65 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-tert-butyl-5-nitro-1H-indole-7-carboxylic acid |