|
CAS#: 953-38-8 Product: 4-(2-Methylaminopropyl)phenol sulfate No suppilers available for the product. |
| Name | 4-(2-Methylaminopropyl)phenol sulfate |
|---|---|
| Synonyms | P-Hydroxy-N-Methylamphetamine Hydrogen Sulfate; Nsc 96983 |
| Molecular Structure | ![]() |
| Molecular Formula | C20H32N2O6S |
| Molecular Weight | 428.54 |
| CAS Registry Number | 953-38-8 |
| EINECS | 228-083-0 |
| SMILES | O=[S](O)(O)=O.C1=CC(=CC=C1CC(NC)C)O.C(C2=CC=C(C=C2)O)C(NC)C |
| InChI | 1S/2C10H15NO.H2O4S/c2*1-8(11-2)7-9-3-5-10(12)6-4-9;1-5(2,3)4/h2*3-6,8,11-12H,7H2,1-2H3;(H2,1,2,3,4) |
| InChIKey | WUORSSYNZWHFQY-UHFFFAOYSA-N |
| Boiling point | 279.4°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 109°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-(2-Methylaminopropyl)phenol sulfate |