Online Database of Chemicals from Around the World
|
CAS#: 95480-21-0 Product: 2,4-Diaminopteridinylglyoxal No suppilers available for the product. |
| Name | 2,4-Diaminopteridinylglyoxal |
|---|---|
| Synonyms | 2-[4-[(2,4-Diaminopteridin-6-Yl)Methylamino]Phenyl]-2-Oxo-Acetaldehyde; 2-[4-[(2,4-Diamino-6-Pteridinyl)Methylamino]Phenyl]-2-Oxoacetaldehyde; 2-[4-[(2,4-Diaminopteridin-6-Yl)Methylamino]Phenyl]-2-Keto-Acetaldehyde |
| Molecular Structure |  |
| Molecular Formula | C15H13N7O2 |
| Molecular Weight | 323.31 |
| CAS Registry Number | 95480-21-0 |
| SMILES | C2=NC1=NC(=NC(=C1N=C2CNC3=CC=C(C=C3)C(=O)C=O)N)N |
| InChI | 1S/C15H13N7O2/c16-13-12-14(22-15(17)21-13)19-6-10(20-12)5-18-9-3-1-8(2-4-9)11(24)7-23/h1-4,6-7,18H,5H2,(H4,16,17,19,21,22) |
| InChIKey | HERAZFNVEIYQTD-UHFFFAOYSA-N |
| Density | 1.539g/cm3 (Cal.) |
|---|---|
| Boiling point | 646.187°C at 760 mmHg (Cal.) |
| Flash point | 344.602°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,4-Diaminopteridinylglyoxal |