|
CAS#: 95719-25-8 Product: 1-(Chloromethyl)-2-(1-Phenylethyl)Benzene No suppilers available for the product. |
| Name | 1-(Chloromethyl)-2-(1-Phenylethyl)Benzene |
|---|---|
| Synonyms | Chloromethyl(1-Phenylethyl)Benzene; Phenylmonochlorotolylethane; Toluene, Chloro(Alpha-Methylbenzyl)- |
| Molecular Structure | ![]() |
| Molecular Formula | C15H15Cl |
| Molecular Weight | 230.74 |
| CAS Registry Number | 95719-25-8 |
| SMILES | C1=CC=CC(=C1C(C2=CC=CC=C2)C)CCl |
| InChI | 1S/C15H15Cl/c1-12(13-7-3-2-4-8-13)15-10-6-5-9-14(15)11-16/h2-10,12H,11H2,1H3 |
| InChIKey | PIMAHAFHAWIYFM-UHFFFAOYSA-N |
| Density | 1.079g/cm3 (Cal.) |
|---|---|
| Boiling point | 321.841°C at 760 mmHg (Cal.) |
| Flash point | 142.897°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(Chloromethyl)-2-(1-Phenylethyl)Benzene |