|
CAS#: 95733-04-3 Product: Daphnodorin C No suppilers available for the product. |
| Name | Daphnodorin C |
|---|---|
| Synonyms | (2S,8S,9S)-4',5,6'-Trihydroxy-2,8-Bis(4-Hydroxyphenyl)Spiro[2,3,4,8-Tetrahydrofuro[5,4-H]Chromene-9,2'-Benzofuran]-3'-One; (2S,8S,9S)-4',5,6'-Trihydroxy-2,8-Bis(4-Hydroxyphenyl)-3'-Spiro[2,3,4,8-Tetrahydrofuro[5,4-H]Chromene-9,2'-Benzofuran]One; Daphnodorin |
| Molecular Structure | ![]() |
| Molecular Formula | C30H22O9 |
| Molecular Weight | 526.50 |
| CAS Registry Number | 95733-04-3 |
| SMILES | [C@]13(OC2=C(C1=O)C(=CC(=C2)O)O)C5=C(O[C@H]3C4=CC=C(O)C=C4)C=C(O)C6=C5O[C@@H](CC6)C7=CC=C(O)C=C7 |
| InChI | 1S/C30H22O9/c31-16-5-1-14(2-6-16)22-10-9-19-20(34)13-24-26(27(19)37-22)30(29(38-24)15-3-7-17(32)8-4-15)28(36)25-21(35)11-18(33)12-23(25)39-30/h1-8,11-13,22,29,31-35H,9-10H2/t22-,29-,30+/m0/s1 |
| InChIKey | ISQNBCHHDNWNEQ-TVNVSJRUSA-N |
| Density | 1.705g/cm3 (Cal.) |
|---|---|
| Boiling point | 865.526°C at 760 mmHg (Cal.) |
| Flash point | 293.862°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Daphnodorin C |