|
CAS#: 95841-71-7 Product: 7-Dehydrocholesterol 5,6-Oxide No suppilers available for the product. |
| Name | 7-Dehydrocholesterol 5,6-Oxide |
|---|---|
| Synonyms | 7-Dehydrocholesterol 5,6-Epoxide; 7-Dehydrocholesterol 5,6-Oxide |
| Molecular Structure | ![]() |
| Molecular Formula | C27H44O2 |
| Molecular Weight | 400.64 |
| CAS Registry Number | 95841-71-7 |
| SMILES | [C@@H]1(CC[C@]2([C@@]5(C1)[C@@H](C=C3[C@@H]2CC[C@]4([C@H]3CC[C@@H]4[C@@H](CCCC(C)C)C)C)O5)C)O |
| InChI | 1S/C27H44O2/c1-17(2)7-6-8-18(3)21-9-10-22-20-15-24-27(29-24)16-19(28)11-14-26(27,5)23(20)12-13-25(21,22)4/h15,17-19,21-24,28H,6-14,16H2,1-5H3/t18-,19+,21-,22+,23+,24-,25-,26-,27-/m1/s1 |
| InChIKey | HQJPDAPYXZGRSF-RMXJHBPESA-N |
| Density | 1.057g/cm3 (Cal.) |
|---|---|
| Boiling point | 506.122°C at 760 mmHg (Cal.) |
| Flash point | 208.043°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 7-Dehydrocholesterol 5,6-Oxide |