|
CAS#: 95873-48-6 Product: (2,2-dimethyl-3-prop-2-enoyloxy-propyl)-dimethyl-ammonium sulfate No suppilers available for the product. |
| Name | (2,2-dimethyl-3-prop-2-enoyloxy-propyl)-dimethyl-ammonium sulfate |
|---|---|
| Synonyms | bis[[3-(a |
| Molecular Structure | ![]() |
| Molecular Formula | C20H40N2O8S |
| Molecular Weight | 468.61 |
| CAS Registry Number | 95873-48-6 |
| EINECS | 306-037-1 |
| SMILES | O=C(OCC(C)(C)C[NH+](C)C)C=C.[O-]S([O-])(=O)=O.C[NH+](C)CC(C)(C)COC(=O)C=C |
| InChI | 1S/2C10H19NO2.H2O4S/c2*1-6-9(12)13-8-10(2,3)7-11(4)5;1-5(2,3)4/h2*6H,1,7-8H2,2-5H3;(H2,1,2,3,4) |
| InChIKey | WJSTVUXBKGTLBZ-UHFFFAOYSA-N |
| Boiling point | 559.4°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 292.1°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2,2-dimethyl-3-prop-2-enoyloxy-propyl)-dimethyl-ammonium sulfate |