|
CAS#: 96-92-4 Product: 6-Chloro-5-nitrotoluene-3-sulphonic acid No suppilers available for the product. |
| Name | 6-Chloro-5-nitrotoluene-3-sulphonic acid |
|---|---|
| Synonyms | 4-Chloro-3-Methyl-5-Nitro-Benzenesulfonic Acid; Nciopen2_002276; 6-Chloro-5-Nitrotoluene-3-Sulphonic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C7H6ClNO5S |
| Molecular Weight | 251.64 |
| CAS Registry Number | 96-92-4 |
| EINECS | 202-545-1 |
| SMILES | C1=C(C(=C(C)C=C1[S](=O)(=O)O)Cl)[N+](=O)[O-] |
| InChI | 1S/C7H6ClNO5S/c1-4-2-5(15(12,13)14)3-6(7(4)8)9(10)11/h2-3H,1H3,(H,12,13,14) |
| InChIKey | OJTXHPQIEJMIJY-UHFFFAOYSA-N |
| Density | 1.653g/cm3 (Cal.) |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 6-Chloro-5-nitrotoluene-3-sulphonic acid |