|
CAS#: 96957-66-3 Product: Isothiobarbamin No suppilers available for the product. |
| Name | Isothiobarbamin |
|---|---|
| Synonyms | 2-(2-Diethylaminoethylsulfanyl)-6-Hydroxy-5-Isopropyl-3H-Pyrimidin-4-One Hydrochloride; 2-(2-Diethylaminoethylthio)-6-Hydroxy-5-Isopropyl-3H-Pyrimidin-4-One Hydrochloride; Mls000075876 |
| Molecular Structure | ![]() |
| Molecular Formula | C13H24ClN3O2S |
| Molecular Weight | 321.86 |
| CAS Registry Number | 96957-66-3 |
| SMILES | [H+].C(N(CC)CC)CSC1=NC(=C(C(C)C)C(=O)N1)O.[Cl-] |
| InChI | 1S/C13H23N3O2S.ClH/c1-5-16(6-2)7-8-19-13-14-11(17)10(9(3)4)12(18)15-13;/h9H,5-8H2,1-4H3,(H2,14,15,17,18);1H |
| InChIKey | OGWDLNIDTJNGDY-UHFFFAOYSA-N |
| Boiling point | 423.8°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 210.1°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Isothiobarbamin |