|
CAS#: 96027-62-2 Product: 1-O-(6-Aminohexanoyl)-2,3-Diphosphoglycerol No suppilers available for the product. |
| Name | 1-O-(6-Aminohexanoyl)-2,3-Diphosphoglycerol |
|---|---|
| Synonyms | 6-Aminohexanoic Acid 2,3-Diphosphonooxypropyl Ester; 1-O-(6-Aminohexanoyl)-2,3-Diphosphoglycerol; Ahdpg |
| Molecular Structure | ![]() |
| Molecular Formula | C9H21NO10P2 |
| Molecular Weight | 365.21 |
| CAS Registry Number | 96027-62-2 |
| SMILES | C(O[P](=O)(O)O)C(O[P](O)(=O)O)COC(CCCCCN)=O |
| InChI | 1S/C9H21NO10P2/c10-5-3-1-2-4-9(11)18-6-8(20-22(15,16)17)7-19-21(12,13)14/h8H,1-7,10H2,(H2,12,13,14)(H2,15,16,17) |
| InChIKey | ZGPSBJPLBWLVJB-UHFFFAOYSA-N |
| Density | 1.55g/cm3 (Cal.) |
|---|---|
| Boiling point | 629.349°C at 760 mmHg (Cal.) |
| Flash point | 334.419°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-O-(6-Aminohexanoyl)-2,3-Diphosphoglycerol |