|
CAS#: 96156-15-9 Product: 5'-Deoxy-5'-Phosphonomethyladenosine Phosphate No suppilers available for the product. |
| Name | 5'-Deoxy-5'-Phosphonomethyladenosine Phosphate |
|---|---|
| Synonyms | 2-[(2R,3S,4R)-5-(6-Aminopurin-9-Yl)-3,4-Dihydroxy-Tetrahydrofuran-2-Yl]Ethyl-Phosphonooxy-Phosphinic Acid; 2-[(2R,3S,4R)-5-(6-Amino-9-Purinyl)-3,4-Dihydroxy-2-Tetrahydrofuranyl]Ethyl-Phosphonooxyphosphinic Acid; 2-[(2R,3S,4R)-5-(6-Aminopurin-9-Yl)-3,4-Dihyd |
| Molecular Structure | ![]() |
| Molecular Formula | C11H17N5O9P2 |
| Molecular Weight | 425.23 |
| CAS Registry Number | 96156-15-9 |
| SMILES | [N]3(C1O[C@@H]([C@@H](O)[C@H]1O)CC[P](O[P](=O)(O)O)(=O)O)C2=NC=NC(=C2N=C3)N |
| InChI | 1S/C11H17N5O9P2/c12-9-6-10(14-3-13-9)16(4-15-6)11-8(18)7(17)5(24-11)1-2-26(19,20)25-27(21,22)23/h3-5,7-8,11,17-18H,1-2H2,(H,19,20)(H2,12,13,14)(H2,21,22,23)/t5-,7-,8-,11?/m1/s1 |
| InChIKey | FANAVXXBPKVMFK-YNJARDAQSA-N |
| Density | 2.354g/cm3 (Cal.) |
|---|---|
| Boiling point | 876.945°C at 760 mmHg (Cal.) |
| Flash point | 484.159°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5'-Deoxy-5'-Phosphonomethyladenosine Phosphate |