|
CAS#: 96446-15-0 Product: 3-[[4-[(6-chloro-1,3-dimethyl-2H-benzimidazol-1-ium-4-yl)azo]phenyl]-ethyl-amino]propanenitrile acetate No suppilers available for the product. |
| Name | 3-[[4-[(6-chloro-1,3-dimethyl-2H-benzimidazol-1-ium-4-yl)azo]phenyl]-ethyl-amino]propanenitrile acetate |
|---|---|
| Synonyms | 6-chloro- |
| Molecular Structure | ![]() |
| Molecular Formula | C22H27ClN6O2 |
| Molecular Weight | 442.94 |
| CAS Registry Number | 96446-15-0 |
| EINECS | 306-142-2 |
| SMILES | [O-]C(C)=O.CCN(CCC#N)c1ccc(cc1)N=Nc2cc(Cl)cc3c2N(C)C[NH+]3C |
| InChI | 1S/C20H23ClN6.C2H4O2/c1-4-27(11-5-10-22)17-8-6-16(7-9-17)23-24-18-12-15(21)13-19-20(18)26(3)14-25(19)2;1-2(3)4/h6-9,12-13H,4-5,11,14H2,1-3H3;1H3,(H,3,4) |
| InChIKey | AXTZLCSSRXDRNO-UHFFFAOYSA-N |
| Boiling point | 696.8°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 375.2°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-[[4-[(6-chloro-1,3-dimethyl-2H-benzimidazol-1-ium-4-yl)azo]phenyl]-ethyl-amino]propanenitrile acetate |