|
CAS#: 96717-73-6 Product: L-Ile-4-(4-Amino-2,5-Cyclohexadien-1-Yl)-L-Abu-OH No suppilers available for the product. |
| Name | L-Ile-4-(4-Amino-2,5-Cyclohexadien-1-Yl)-L-Abu-OH |
|---|---|
| Synonyms | (2S)-4-(4-Amino-1-Cyclohexa-2,5-Dienyl)-2-[[(2S,3S)-2-Amino-3-Methyl-Pentanoyl]Amino]Butanoic Acid; (2S)-4-(4-Amino-1-Cyclohexa-2,5-Dienyl)-2-[[(2S,3S)-2-Amino-3-Methyl-1-Oxopentyl]Amino]Butanoic Acid; (2S)-4-(4-Amino-1-Cyclohexa-2,5-Dienyl)-2-[[(2S,3S)-2-A |
| Molecular Structure | ![]() |
| Molecular Formula | C16H27N3O3 |
| Molecular Weight | 309.41 |
| CAS Registry Number | 96717-73-6 |
| SMILES | [C@H](C(=O)O)(NC([C@@H](N)[C@H](CC)C)=O)CCC1C=CC(C=C1)N |
| InChI | 1S/C16H27N3O3/c1-3-10(2)14(18)15(20)19-13(16(21)22)9-6-11-4-7-12(17)8-5-11/h4-5,7-8,10-14H,3,6,9,17-18H2,1-2H3,(H,19,20)(H,21,22)/t10-,11?,12?,13-,14-/m0/s1 |
| InChIKey | AFBIDHYBVNNJGJ-ASUPZPJHSA-N |
| Density | 1.123g/cm3 (Cal.) |
|---|---|
| Boiling point | 536.24°C at 760 mmHg (Cal.) |
| Flash point | 278.108°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for L-Ile-4-(4-Amino-2,5-Cyclohexadien-1-Yl)-L-Abu-OH |