|
CAS#: 96792-67-5 Product: 1-(Hexahydro-3,6-dimethyl-1H-Benzindenyl)-Ethanon No suppilers available for the product. |
| Name | 1-(Hexahydro-3,6-dimethyl-1H-Benzindenyl)-Ethanon |
|---|---|
| Synonyms | Ethanone, 1-(Hexahydrodimethyl-1H-Benzindenyl)- |
| Molecular Structure | ![]() |
| Molecular Formula | C12H21NO |
| Molecular Weight | 195.30 |
| CAS Registry Number | 96792-67-5 |
| SMILES | [C@@H]1(CN(C(C)=O)[C@H]2[C@H]1CC[C@H](C2)C)C |
| InChI | 1S/C12H21NO/c1-8-4-5-11-9(2)7-13(10(3)14)12(11)6-8/h8-9,11-12H,4-7H2,1-3H3/t8-,9+,11+,12-/m1/s1 |
| InChIKey | IYQXQRZPAZBRCU-LLHIFLOGSA-N |
| Density | 0.962g/cm3 (Cal.) |
|---|---|
| Boiling point | 305.374°C at 760 mmHg (Cal.) |
| Flash point | 126.804°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(Hexahydro-3,6-dimethyl-1H-Benzindenyl)-Ethanon |