Online Database of Chemicals from Around the World
|
CAS#: 96839-31-5 Product: Przewaquinone F No suppilers available for the product. |
| Name | Przewaquinone F |
|---|---|
| Synonyms | 7-Hydroxy-6-(Hydroxymethyl)-1-Methyl-6,7,8,9-Tetrahydronaphtho[5,6-G]Benzofuran-10,11-Dione; 7-Hydroxy-1-Methyl-6-Methylol-6,7,8,9-Tetrahydronaphtho[5,6-G]Benzofuran-10,11-Quinone; Phenanthro(1,2-B)Furan-10,11-Dione, 6,7,8,9-Tetrahydro-7-Hydroxy-6-(Hydroxym |
| Molecular Structure |  |
| Molecular Formula | C18H16O5 |
| Molecular Weight | 312.32 |
| CAS Registry Number | 96839-31-5 |
| SMILES | C1=CC3=C(C2=C1C(C(CC2)O)CO)C(C(C4=C3OC=C4C)=O)=O |
| InChI | 1S/C18H16O5/c1-8-7-23-18-11-3-2-9-10(4-5-13(20)12(9)6-19)15(11)17(22)16(21)14(8)18/h2-3,7,12-13,19-20H,4-6H2,1H3 |
| InChIKey | OUFIJYAHFBAFBX-UHFFFAOYSA-N |
| Density | 1.416g/cm3 (Cal.) |
|---|---|
| Boiling point | 595.025°C at 760 mmHg (Cal.) |
| Flash point | 313.66°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Przewaquinone F |