|
CAS#: 96881-39-9 Product: 4,6,7-Trimethyl-1H-imidazo[1,2-a]purin-9-one No suppilers available for the product. |
| Name | 4,6,7-Trimethyl-1H-imidazo[1,2-a]purin-9-one |
|---|---|
| Synonyms | 7-Methylwye |
| Molecular Structure | ![]() |
| Molecular Formula | C10H11N5O |
| Molecular Weight | 217.23 |
| CAS Registry Number | 96881-39-9 |
| SMILES | C1=NC3=C([NH]1)C([N]2C(=NC(=C2C)C)N3C)=O |
| InChI | 1S/C10H11N5O/c1-5-6(2)15-9(16)7-8(12-4-11-7)14(3)10(15)13-5/h4H,1-3H3,(H,11,12) |
| InChIKey | KKLICVWZFMVCEV-UHFFFAOYSA-N |
| Density | 1.569g/cm3 (Cal.) |
|---|---|
| Boiling point | 635.348°C at 760 mmHg (Cal.) |
| Flash point | 338.047°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,6,7-Trimethyl-1H-imidazo[1,2-a]purin-9-one |