|
CAS#: 96888-50-5 Product: 2-Methyl-5-Phytylbenzoquinone No suppilers available for the product. |
| Name | 2-Methyl-5-Phytylbenzoquinone |
|---|---|
| Synonyms | 2-Methyl-5-[(E,7R,11R)-3,7,11,15-Tetramethylhexadec-2-Enyl]-1,4-Benzoquinone; 2-Methyl-5-[(E,7R,11R)-3,7,11,15-Tetramethylhexadec-2-Enyl]-P-Benzoquinone; 2-Methyl-5-Phytylbenzoquinone |
| Molecular Structure | ![]() |
| Molecular Formula | C27H44O2 |
| Molecular Weight | 400.64 |
| CAS Registry Number | 96888-50-5 |
| SMILES | [C@H](CCC/C(=C/CC1=CC(=O)C(=CC1=O)C)C)(CCC[C@@H](CCCC(C)C)C)C |
| InChI | 1S/C27H44O2/c1-20(2)10-7-11-21(3)12-8-13-22(4)14-9-15-23(5)16-17-25-19-26(28)24(6)18-27(25)29/h16,18-22H,7-15,17H2,1-6H3/b23-16+/t21-,22-/m1/s1 |
| InChIKey | QHMSZTFWKLGBBI-UOFXASEASA-N |
| Density | 0.929g/cm3 (Cal.) |
|---|---|
| Boiling point | 482.859°C at 760 mmHg (Cal.) |
| Flash point | 179.077°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Methyl-5-Phytylbenzoquinone |