|
CAS#: 96914-16-8 Product: Lysyl-5-Fluorotryptophyl-Lysine No suppilers available for the product. |
| Name | Lysyl-5-Fluorotryptophyl-Lysine |
|---|---|
| Synonyms | (2S)-6-Amino-2-[[(2S)-2-[[(2S)-2,6-Diamino-1-Oxohexyl]Amino]-3-(5-Fluoro-1H-Indol-3-Yl)-1-Oxopropyl]Amino]Hexanoic Acid; L-Lysine, N2-(5-Fluoro-N-L-Lysyl-L-Tryptophyl)-; Lys-F-Trp-Lys |
| Molecular Structure | ![]() |
| Molecular Formula | C23H35FN6O4 |
| Molecular Weight | 478.57 |
| CAS Registry Number | 96914-16-8 |
| SMILES | [C@H](CC1=C[NH]C2=CC=C(C=C12)F)(C(N[C@@H](CCCCN)C(=O)O)=O)NC(=O)[C@@H](N)CCCCN |
| InChI | 1S/C23H35FN6O4/c24-15-7-8-18-16(12-15)14(13-28-18)11-20(30-21(31)17(27)5-1-3-9-25)22(32)29-19(23(33)34)6-2-4-10-26/h7-8,12-13,17,19-20,28H,1-6,9-11,25-27H2,(H,29,32)(H,30,31)(H,33,34)/t17-,19-,20-/m0/s1 |
| InChIKey | VJVZKOMQEQQESV-IHPCNDPISA-N |
| Density | 1.286g/cm3 (Cal.) |
|---|---|
| Boiling point | 862.001°C at 760 mmHg (Cal.) |
| Flash point | 475.121°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Lysyl-5-Fluorotryptophyl-Lysine |