|
CAS#: 97-34-7 Product: 3-Amino-4-(p-aminoanilino)benzenesulphonic acid No suppilers available for the product. |
| Name | 3-Amino-4-(p-aminoanilino)benzenesulphonic acid |
|---|---|
| Synonyms | 3-Amino-4-(P-Aminoanilino)Benzenesulphonic Acid; Benzenesulfonic Acid, 3-Amino-4-((4-Aminophenyl)Amino)- |
| Molecular Structure | ![]() |
| Molecular Formula | C12H13N3O3S |
| Molecular Weight | 279.31 |
| CAS Registry Number | 97-34-7 |
| EINECS | 202-573-4 |
| SMILES | C1=CC(=C(C=C1[S](=O)(=O)O)N)NC2=CC=C(C=C2)N |
| InChI | 1S/C12H13N3O3S/c13-8-1-3-9(4-2-8)15-12-6-5-10(7-11(12)14)19(16,17)18/h1-7,15H,13-14H2,(H,16,17,18) |
| InChIKey | ACKJQSTXPUVROE-UHFFFAOYSA-N |
| Density | 1.528g/cm3 (Cal.) |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 3-Amino-4-(p-aminoanilino)benzenesulphonic acid |