| DSL Chemicals (Shanghai) Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 (21) 6352-9955 | |||
![]() |
info@dsl-chem.com | |||
| Chemical manufacturer since 1997 | ||||
| Name | Hexanoic Acid, 2,6-Diisocyanato-, 2-Isocyanatoethyl Ester |
|---|---|
| Synonyms | 2,6-Diisocyanatohexanoic Acid 2-Isocyanatoethyl Ester; 2,6-Diisocyanatohexanoic Acid, 2-Isocyanatoethyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C11H13N3O5 |
| Molecular Weight | 267.24 |
| CAS Registry Number | 97042-86-9 |
| EINECS | 274-179-0 |
| SMILES | O=C=NC(C(OCCN=C=O)=O)CCCCN=C=O |
| InChI | 1S/C11H13N3O5/c15-7-12-4-2-1-3-10(14-9-17)11(18)19-6-5-13-8-16/h10H,1-6H2 |
| InChIKey | GNDOBZLRZOCGAS-UHFFFAOYSA-N |
| Density | 1.217g/cm3 (Cal.) |
|---|---|
| Boiling point | 382.878°C at 760 mmHg (Cal.) |
| Flash point | 168.12°C (Cal.) |
| (1) | Masahiro Suzuki, Yasushi Nakajima, Mariko Yumoto, Mutsumi Kimura, Hirofusa Shirai and Kenji Hanabusa. In situ organogelation at room temperature: direct synthesis of gelators in organic solvents, Org. Biomol. Chem., 2004, 2, 1155. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Hexanoic Acid, 2,6-Diisocyanato-, 2-Isocyanatoethyl Ester |